CAS 2414896-78-7 appears in our catalog under these names: 2-(3-Fluorophenyl)-5-iodo-1,3-thiazole, 97%, 2-(3-Fluorophenyl)-5-iodothiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g, 10g.
2-(3-fluorophenyl)-5-iodo-1,3-thiazole (CAS 2414896-78-7) is a chemical compound with the molecular formula C9H5FINS and a molecular weight of 305.11 g/mol. IUPAC name: 2-(3-fluorophenyl)-5-iodo-1,3-thiazole. InChIKey: INLZEVXDSADVTH-UHFFFAOYSA-N.
| Molecular formula | C9H5FINS |
|---|---|
| Molecular weight | 305.11 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-5-iodo-1,3-thiazole |
| InChIKey | INLZEVXDSADVTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC=C(S2)I |
Computed by PubChem (NCBI)