Products 2414908-90-8
CAS 2414908-90-8 appears in our catalog under these names: HKB99/ 97.35% (existing batch purity), HKB99, HKB99, 98.58%, HKB99, 97%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 25 mg, 10 mg, 5 mg, 50 mg, 5mg.
4-(azetidin-1-yl)-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide (CAS 2414908-90-8) is a chemical compound with the molecular formula C23H18N2O6S and a molecular weight of 450.5 g/mol. IUPAC name: 4-(azetidin-1-yl)-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide. InChIKey: ZSFURBMYHHMIKE-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O6S |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | 4-(azetidin-1-yl)-N-(3,4-dihydroxy-9,10-dioxoanthracen-2-yl)benzenesulfonamide |
| InChIKey | ZSFURBMYHHMIKE-UHFFFAOYSA-N |
| SMILES | C1CN(C1)C2=CC=C(C=C2)S(=O)(=O)NC3=C(C(=C4C(=C3)C(=O)C5=CC=CC=C5C4=O)O)O |
Computed by PubChem (NCBI)