CAS 2415206-22-1 appears in our catalog under these names: TRPA1–IN–2 , TRPA1-IN-2, 98%, TRPA1-IN-2/ 98.05% (existing batch purity), TRPA1-IN-2, 99.82%, TRPA1-IN-2, 95%, 95%. Offered by: GLPBio, AmBeed, TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 10mM/1mL.
4-[[1-[4-[4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]cyclopentyl]amino]benzonitrile (CAS 2415206-22-1) is a chemical compound with the molecular formula C24H25F3N4O and a molecular weight of 442.5 g/mol. IUPAC name: 4-[[1-[4-[4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]cyclopentyl]amino]benzonitrile. InChIKey: QBMIXUICHJFOFY-UHFFFAOYSA-N.
| Molecular formula | C24H25F3N4O |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 4-[[1-[4-[4-(trifluoromethyl)phenyl]piperazine-1-carbonyl]cyclopentyl]amino]benzonitrile |
| InChIKey | QBMIXUICHJFOFY-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C(=O)N2CCN(CC2)C3=CC=C(C=C3)C(F)(F)F)NC4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)