CAS 2415255-56-8 is the registry number for 4-Chloro-7-iodoisoxazolo[4,5-c]pyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-7-iodo-[1,2]oxazolo[4,5-c]pyridin-3-amine (CAS 2415255-56-8) is a chemical compound with the molecular formula C6H3ClIN3O and a molecular weight of 295.46 g/mol. IUPAC name: 4-chloro-7-iodo-[1,2]oxazolo[4,5-c]pyridin-3-amine. InChIKey: AOJAEGQYWAFVMW-UHFFFAOYSA-N.
| Molecular formula | C6H3ClIN3O |
|---|---|
| Molecular weight | 295.46 g/mol |
| IUPAC name | 4-chloro-7-iodo-[1,2]oxazolo[4,5-c]pyridin-3-amine |
| InChIKey | AOJAEGQYWAFVMW-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(C(=NO2)N)C(=N1)Cl)I |
Computed by PubChem (NCBI)