CAS 2415312-60-4 is the registry number for (1R,5S,6R)-6-(4H-1,2,4-triazol-4-yl)-3-azabicyclo[3.1.0]hexane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,5R)-6-(1,2,4-triazol-4-yl)-3-azabicyclo[3.1.0]hexane (CAS 2415312-60-4) is a chemical compound with the molecular formula C7H10N4 and a molecular weight of 150.18 g/mol. IUPAC name: (1S,5R)-6-(1,2,4-triazol-4-yl)-3-azabicyclo[3.1.0]hexane. InChIKey: SFXVDDCAOLDPIL-MEKDEQNOSA-N.
| Molecular formula | C7H10N4 |
|---|---|
| Molecular weight | 150.18 g/mol |
| IUPAC name | (1S,5R)-6-(1,2,4-triazol-4-yl)-3-azabicyclo[3.1.0]hexane |
| InChIKey | SFXVDDCAOLDPIL-MEKDEQNOSA-N |
| SMILES | C1[C@@H]2[C@@H](C2N3C=NN=C3)CN1 |
Computed by PubChem (NCBI)