CAS 2415364-10-0 is the registry number for (Z)-8-(2-Bromovinyl)-5-fluoro-2,2-dimethyl-4H-benzo[d][1,3]dioxin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-[(Z)-2-bromoethenyl]-5-fluoro-2,2-dimethyl-1,3-benzodioxin-4-one (CAS 2415364-10-0) is a chemical compound with the molecular formula C12H10BrFO3 and a molecular weight of 301.11 g/mol. IUPAC name: 8-[(Z)-2-bromoethenyl]-5-fluoro-2,2-dimethyl-1,3-benzodioxin-4-one. InChIKey: CBYJSPOLTWZYAX-WAYWQWQTSA-N.
| Molecular formula | C12H10BrFO3 |
|---|---|
| Molecular weight | 301.11 g/mol |
| IUPAC name | 8-[(Z)-2-bromoethenyl]-5-fluoro-2,2-dimethyl-1,3-benzodioxin-4-one |
| InChIKey | CBYJSPOLTWZYAX-WAYWQWQTSA-N |
| SMILES | CC1(OC2=C(C=CC(=C2C(=O)O1)F)/C=C\Br)C |
Computed by PubChem (NCBI)