CAS 2415368-15-7 is the registry number for rel-tert-Butyl((1r,3r)-3-(iodomethyl)cyclobutoxy)dimethylsilane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl-[3-(iodomethyl)cyclobutyl]oxy-dimethylsilane (CAS 2415368-15-7) is a chemical compound with the molecular formula C11H23IOSi and a molecular weight of 326.29 g/mol. IUPAC name: tert-butyl-[3-(iodomethyl)cyclobutyl]oxy-dimethylsilane. InChIKey: YGTJZPKNQSLERH-UHFFFAOYSA-N.
| Molecular formula | C11H23IOSi |
|---|---|
| Molecular weight | 326.29 g/mol |
| IUPAC name | tert-butyl-[3-(iodomethyl)cyclobutyl]oxy-dimethylsilane |
| InChIKey | YGTJZPKNQSLERH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(C1)CI |
Computed by PubChem (NCBI)