CAS 2416-95-7 appears in our catalog under these names: Dipropofol, >95% (HPLC), 3,3',5,5'-Tetraisopropylbiphenyl-4,4'-diol, 95%, Propofol EP Impurity E, 3,3',5,5'-Tetrakis(1-methylethyl)biphenyl-4,4'-diol, Dipropofol/ 99.6% (existing batch purity). Offered by: TRC, Combi-blocks, Chemat Brand, Mikromol, LoGiCal. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, on request, 25mg, 10mg.
4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-2,6-di(propan-2-yl)phenol (CAS 2416-95-7) is a chemical compound with the molecular formula C24H34O2 and a molecular weight of 354.5 g/mol. IUPAC name: 4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-2,6-di(propan-2-yl)phenol. InChIKey: QAISRHCMPQROAX-UHFFFAOYSA-N.
| Molecular formula | C24H34O2 |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | 4-[4-hydroxy-3,5-di(propan-2-yl)phenyl]-2,6-di(propan-2-yl)phenol |
| InChIKey | QAISRHCMPQROAX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)C2=CC(=C(C(=C2)C(C)C)O)C(C)C |
Computed by PubChem (NCBI)