CAS 2416016-24-3 is the registry number for (3-(3,3-Dimethylbut-1-yn-1-yl)-1H-indol-2-yl)diphenylmethanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(3,3-dimethylbut-1-ynyl)-1H-indol-2-yl]-diphenylmethanol (CAS 2416016-24-3) is a chemical compound with the molecular formula C27H25NO and a molecular weight of 379.5 g/mol. IUPAC name: [3-(3,3-dimethylbut-1-ynyl)-1H-indol-2-yl]-diphenylmethanol. InChIKey: NWAJIZHFNDICSQ-UHFFFAOYSA-N.
| Molecular formula | C27H25NO |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | [3-(3,3-dimethylbut-1-ynyl)-1H-indol-2-yl]-diphenylmethanol |
| InChIKey | NWAJIZHFNDICSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C#CC1=C(NC2=CC=CC=C21)C(C3=CC=CC=C3)(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)