CAS 2416016-40-3 is the registry number for (3-(3,3-Dimethylbut-1-yn-1-yl)-1H-indol-2-yl)di-p-tolylmethanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(3,3-dimethylbut-1-ynyl)-1H-indol-2-yl]-bis(4-methylphenyl)methanol (CAS 2416016-40-3) is a chemical compound with the molecular formula C29H29NO and a molecular weight of 407.5 g/mol. IUPAC name: [3-(3,3-dimethylbut-1-ynyl)-1H-indol-2-yl]-bis(4-methylphenyl)methanol. InChIKey: ILPAAUMRVOSREY-UHFFFAOYSA-N.
| Molecular formula | C29H29NO |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | [3-(3,3-dimethylbut-1-ynyl)-1H-indol-2-yl]-bis(4-methylphenyl)methanol |
| InChIKey | ILPAAUMRVOSREY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=C(C=C2)C)(C3=C(C4=CC=CC=C4N3)C#CC(C)(C)C)O |
Computed by PubChem (NCBI)