Products 2416031-22-4
CAS 2416031-22-4 is the registry number for Ethyl 4-Bromo-6-chloro-7-fluoro-1H-indole-2-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 4-bromo-6-chloro-7-fluoro-1H-indole-2-carboxylate (CAS 2416031-22-4) is a chemical compound with the molecular formula C11H8BrClFNO2 and a molecular weight of 320.54 g/mol. IUPAC name: ethyl 4-bromo-6-chloro-7-fluoro-1H-indole-2-carboxylate. InChIKey: CBQSJCWKIKVDFJ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrClFNO2 |
|---|---|
| Molecular weight | 320.54 g/mol |
| IUPAC name | ethyl 4-bromo-6-chloro-7-fluoro-1H-indole-2-carboxylate |
| InChIKey | CBQSJCWKIKVDFJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C(C(=C2N1)F)Cl)Br |
Computed by PubChem (NCBI)