Products 3065251-76-2
CAS 3065251-76-2 is the registry number for CRBN ligand-84. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-bromo-2-chloro-6-fluorophenyl)piperidine-2,6-dione (CAS 3065251-76-2) is a chemical compound with the molecular formula C11H8BrClFNO2 and a molecular weight of 320.54 g/mol. IUPAC name: 3-(4-bromo-2-chloro-6-fluorophenyl)piperidine-2,6-dione. InChIKey: IKPSVIGFJBRJTK-UHFFFAOYSA-N.
| Molecular formula | C11H8BrClFNO2 |
|---|---|
| Molecular weight | 320.54 g/mol |
| IUPAC name | 3-(4-bromo-2-chloro-6-fluorophenyl)piperidine-2,6-dione |
| InChIKey | IKPSVIGFJBRJTK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=C(C=C(C=C2Cl)Br)F |
Computed by PubChem (NCBI)