Products 2416046-72-3
CAS 2416046-72-3 is the registry number for N'-(4-Bromo-3-fluorobenzylidene)-4-methylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 10g, 5g, 1g.
N-[(E)-(4-bromo-3-fluorophenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 2416046-72-3) is a chemical compound with the molecular formula C14H12BrFN2O2S and a molecular weight of 371.23 g/mol. IUPAC name: N-[(E)-(4-bromo-3-fluorophenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: KJVVLSUGWRKGPA-RQZCQDPDSA-N.
| Molecular formula | C14H12BrFN2O2S |
|---|---|
| Molecular weight | 371.23 g/mol |
| IUPAC name | N-[(E)-(4-bromo-3-fluorophenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | KJVVLSUGWRKGPA-RQZCQDPDSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)