CAS 2416056-43-2 is the registry number for (2,2-Difluoro-7,10-dioxadispiro[2.2.4.23]dodecan-1-yl)-trifluoro-boranuide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,2-difluoro-7,10-dioxadispiro[2.2.46.23]dodecan-1-yl)-trifluoroboranuide (CAS 2416056-43-2) is a chemical compound with the molecular formula C10H13BF5O2- and a molecular weight of 271.01 g/mol. IUPAC name: (2,2-difluoro-7,10-dioxadispiro[2.2.46.23]dodecan-1-yl)-trifluoroboranuide. InChIKey: WODDCBBRWBOJNF-UHFFFAOYSA-N.
| Molecular formula | C10H13BF5O2- |
|---|---|
| Molecular weight | 271.01 g/mol |
| IUPAC name | (2,2-difluoro-7,10-dioxadispiro[2.2.46.23]dodecan-1-yl)-trifluoroboranuide |
| InChIKey | WODDCBBRWBOJNF-UHFFFAOYSA-N |
| SMILES | [B-](C1C2(C1(F)F)CCC3(CC2)OCCO3)(F)(F)F |
Computed by PubChem (NCBI)