CAS 2416146-01-3 is the registry number for N-(2-Amino-4-bromo-6-chlorophenyl)methanesulfonamide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(2-amino-4-bromo-6-chlorophenyl)methanesulfonamide (CAS 2416146-01-3) is a chemical compound with the molecular formula C7H8BrClN2O2S and a molecular weight of 299.57 g/mol. IUPAC name: N-(2-amino-4-bromo-6-chlorophenyl)methanesulfonamide. InChIKey: RRFBLPYWNKTKFX-UHFFFAOYSA-N.
| Molecular formula | C7H8BrClN2O2S |
|---|---|
| Molecular weight | 299.57 g/mol |
| IUPAC name | N-(2-amino-4-bromo-6-chlorophenyl)methanesulfonamide |
| InChIKey | RRFBLPYWNKTKFX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=C(C=C1Cl)Br)N |
Computed by PubChem (NCBI)