CAS 2416241-95-5 appears in our catalog under these names: Vonoprazan Impurity 5, Vonoprazan Impurity V, Vonoprazan Impuirty 28. Offered by: Chemat Brand. Available pack sizes: on request.
1-[1-(1,2-dihydropyridin-5-ylsulfonyl)-5-(2-fluorophenyl)pyrrol-3-yl]-N-methylmethanamine (CAS 2416241-95-5) is a chemical compound with the molecular formula C17H18FN3O2S and a molecular weight of 347.4 g/mol. IUPAC name: 1-[1-(1,2-dihydropyridin-5-ylsulfonyl)-5-(2-fluorophenyl)pyrrol-3-yl]-N-methylmethanamine. InChIKey: QRENYOFWNSJPRB-UHFFFAOYSA-N.
| Molecular formula | C17H18FN3O2S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 1-[1-(1,2-dihydropyridin-5-ylsulfonyl)-5-(2-fluorophenyl)pyrrol-3-yl]-N-methylmethanamine |
| InChIKey | QRENYOFWNSJPRB-UHFFFAOYSA-N |
| SMILES | CNCC1=CN(C(=C1)C2=CC=CC=C2F)S(=O)(=O)C3=CNCC=C3 |
Computed by PubChem (NCBI)