Products 2416268-43-2
CAS 2416268-43-2 is the registry number for (3R)-1,2,3,5,6,7-Hexahydro-3-methyldicyclopenta[b,e]pyridin-8-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4R)-4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-amine (CAS 2416268-43-2) is a chemical compound with the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. IUPAC name: (4R)-4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-amine. InChIKey: DBPYBCVDOATROT-SSDOTTSWSA-N.
| Molecular formula | C12H16N2 |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | (4R)-4-methyl-2-azatricyclo[7.3.0.03,7]dodeca-1(9),2,7-trien-8-amine |
| InChIKey | DBPYBCVDOATROT-SSDOTTSWSA-N |
| SMILES | C[C@@H]1CCC2=C(C3=C(CCC3)N=C12)N |
Computed by PubChem (NCBI)