CAS 35998-04-0 appears in our catalog under these names: 6-Methylgramine, 95%, N,N-Dimethyl-1-(6-methyl-1H-indol-3-yl)methanamine, 95+%, 6-Methylgramine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg, 50mg.
N,N-dimethyl-1-(6-methyl-1H-indol-3-yl)methanamine (CAS 35998-04-0) is a chemical compound with the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. IUPAC name: N,N-dimethyl-1-(6-methyl-1H-indol-3-yl)methanamine. InChIKey: GXMYBIFUWSMMKX-UHFFFAOYSA-N.
| Molecular formula | C12H16N2 |
|---|---|
| Molecular weight | 188.27 g/mol |
| IUPAC name | N,N-dimethyl-1-(6-methyl-1H-indol-3-yl)methanamine |
| InChIKey | GXMYBIFUWSMMKX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2)CN(C)C |
Computed by PubChem (NCBI)