Products 2416269-15-1
CAS 2416269-15-1 is the registry number for Satoprodil. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-4-[[5-(2-fluoro-4-methylphenoxy)pyrazin-2-yl]methyl]-N-methylmorpholine-2-carboxamide (CAS 2416269-15-1) is a chemical compound with the molecular formula C18H21FN4O3 and a molecular weight of 360.4 g/mol. IUPAC name: (2S)-4-[[5-(2-fluoro-4-methylphenoxy)pyrazin-2-yl]methyl]-N-methylmorpholine-2-carboxamide. InChIKey: LTPRQGCLGGENCK-INIZCTEOSA-N.
| Molecular formula | C18H21FN4O3 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | (2S)-4-[[5-(2-fluoro-4-methylphenoxy)pyrazin-2-yl]methyl]-N-methylmorpholine-2-carboxamide |
| InChIKey | LTPRQGCLGGENCK-INIZCTEOSA-N |
| SMILES | CC1=CC(=C(C=C1)OC2=NC=C(N=C2)CN3CCO[C@@H](C3)C(=O)NC)F |
Computed by PubChem (NCBI)