CAS 2416301-31-8 appears in our catalog under these names: Dibromo-pyridazinedione-propionic acid, 4,5-Dibromo-3,6-dihydro-2-methyl-3,6-dioxo-1(2H)-pyridazinepropanoic acid, 95%, 95%. Offered by: Iris Biotech, Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g.
3-(4,5-dibromo-2-methyl-3,6-dioxopyridazin-1-yl)propanoic acid (CAS 2416301-31-8) is a chemical compound with the molecular formula C8H8Br2N2O4 and a molecular weight of 355.97 g/mol. IUPAC name: 3-(4,5-dibromo-2-methyl-3,6-dioxopyridazin-1-yl)propanoic acid. InChIKey: ZQZIMFQDLZIXGZ-UHFFFAOYSA-N.
| Molecular formula | C8H8Br2N2O4 |
|---|---|
| Molecular weight | 355.97 g/mol |
| IUPAC name | 3-(4,5-dibromo-2-methyl-3,6-dioxopyridazin-1-yl)propanoic acid |
| InChIKey | ZQZIMFQDLZIXGZ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(C(=O)N1CCC(=O)O)Br)Br |
Computed by PubChem (NCBI)