Products 2416400-32-1
CAS 2416400-32-1 is the registry number for DNA Gyrase-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(4-chlorophenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methyl] 6-chloro-2-oxochromene-3-carboxylate (CAS 2416400-32-1) is a chemical compound with the molecular formula C22H15Cl2NO4S and a molecular weight of 460.3 g/mol. IUPAC name: [(4-chlorophenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methyl] 6-chloro-2-oxochromene-3-carboxylate. InChIKey: YMHLFZHIJKICAJ-UHFFFAOYSA-N.
| Molecular formula | C22H15Cl2NO4S |
|---|---|
| Molecular weight | 460.3 g/mol |
| IUPAC name | [(4-chlorophenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methyl] 6-chloro-2-oxochromene-3-carboxylate |
| InChIKey | YMHLFZHIJKICAJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C(C2=CC=C(C=C2)Cl)OC(=O)C3=CC4=C(C=CC(=C4)Cl)OC3=O)C |
Computed by PubChem (NCBI)
Synonyms:
DNA Gyrase-IN-4, orb1687147