CAS 24165-03-5 appears in our catalog under these names: Triphenylmethanesulfenyl chloride, 98%, Triphenylmethanesulfenyl Chloride, Triphenylmethanesulfenyl Chloride, Triphenylmethanesulfenyl Chloride, >96.0%(HPLC)(T), Triphenylmethanesulfenylchloride 96%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 5g, 10g, 2,5g, 25g, 250mg.
Trityl thiohypochlorite (CAS 24165-03-5) is a chemical compound with the molecular formula C19H15ClS and a molecular weight of 310.8 g/mol. IUPAC name: trityl thiohypochlorite. InChIKey: ZTQHJLXIUQQVST-UHFFFAOYSA-N.
| Molecular formula | C19H15ClS |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | trityl thiohypochlorite |
| InChIKey | ZTQHJLXIUQQVST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCl |
Computed by PubChem (NCBI)