CAS 24167-51-9 appears in our catalog under these names: 3–Bromo–N,N–dimethylbenzamide, 3-Bromo-n,n-dimethylbenzamide, 3-Bromo-N,N-dimethylbenzamide 98%, 3-Bromo-N,N-dimethylbenzamide, 97%, 97%, 3-Bromo-N,N-dimethylbenzamide, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 10g, 100g.
3-bromo-N,N-dimethylbenzamide (CAS 24167-51-9) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 3-bromo-N,N-dimethylbenzamide. InChIKey: CGEIMYMVLYZNRJ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 3-bromo-N,N-dimethylbenzamide |
| InChIKey | CGEIMYMVLYZNRJ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)