CAS 24167-52-0 appears in our catalog under these names: 3–Chloro–N,N–dimethylbenzamide, 3-Chloro-N,N-dimethylbenzamide, 98%, 98%, 3-Chloro-N,N-dimethylbenzamide, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g.
3-chloro-N,N-dimethylbenzamide (CAS 24167-52-0) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: 3-chloro-N,N-dimethylbenzamide. InChIKey: JSXDHOISXRKLGG-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | 3-chloro-N,N-dimethylbenzamide |
| InChIKey | JSXDHOISXRKLGG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)