Products 2416852-90-7
CAS 2416852-90-7 is the registry number for 7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)cinnoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cinnoline (CAS 2416852-90-7) is a chemical compound with the molecular formula C14H17BN2O2 and a molecular weight of 256.11 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cinnoline. InChIKey: DFQSAQGFXXZCHT-UHFFFAOYSA-N.
| Molecular formula | C14H17BN2O2 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cinnoline |
| InChIKey | DFQSAQGFXXZCHT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=CN=N3 |
Computed by PubChem (NCBI)