Products 2416957-09-8
CAS 2416957-09-8 is the registry number for Cavα2δ-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-ethyl-2-[(1R)-1-[(3R)-3-methylpiperazin-1-yl]butyl]pyrido[4,3-d]pyrimidin-4-one (CAS 2416957-09-8) is a chemical compound with the molecular formula C18H27N5O and a molecular weight of 329.4 g/mol. IUPAC name: 3-ethyl-2-[(1R)-1-[(3R)-3-methylpiperazin-1-yl]butyl]pyrido[4,3-d]pyrimidin-4-one. InChIKey: RFQYUCNHWNYTNR-CZUORRHYSA-N.
| Molecular formula | C18H27N5O |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 3-ethyl-2-[(1R)-1-[(3R)-3-methylpiperazin-1-yl]butyl]pyrido[4,3-d]pyrimidin-4-one |
| InChIKey | RFQYUCNHWNYTNR-CZUORRHYSA-N |
| SMILES | CCC[C@H](C1=NC2=C(C=NC=C2)C(=O)N1CC)N3CCN[C@@H](C3)C |
Computed by PubChem (NCBI)