CAS 2416992-28-2 is the registry number for 2-Bromo-6-(tert-butyl)-3,5-dichloropyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6-tert-butyl-3,5-dichloropyridine (CAS 2416992-28-2) is a chemical compound with the molecular formula C9H10BrCl2N and a molecular weight of 282.99 g/mol. IUPAC name: 2-bromo-6-tert-butyl-3,5-dichloropyridine. InChIKey: JUDMIHUYBBEFCG-UHFFFAOYSA-N.
| Molecular formula | C9H10BrCl2N |
|---|---|
| Molecular weight | 282.99 g/mol |
| IUPAC name | 2-bromo-6-tert-butyl-3,5-dichloropyridine |
| InChIKey | JUDMIHUYBBEFCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=C(C=C1Cl)Cl)Br |
Computed by PubChem (NCBI)