CAS 2417009-70-0 is the registry number for Sodium 3-(methoxycarbonyl)bicyclo[1.1.1]pentane-1-sulfinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 3-methoxycarbonylbicyclo[1.1.1]pentane-1-sulfinate (CAS 2417009-70-0) is a chemical compound with the molecular formula C7H9NaO4S and a molecular weight of 212.20 g/mol. IUPAC name: sodium 3-methoxycarbonylbicyclo[1.1.1]pentane-1-sulfinate. InChIKey: PSXKBVHJOKKKTI-UHFFFAOYSA-M.
| Molecular formula | C7H9NaO4S |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | sodium 3-methoxycarbonylbicyclo[1.1.1]pentane-1-sulfinate |
| InChIKey | PSXKBVHJOKKKTI-UHFFFAOYSA-M |
| SMILES | COC(=O)C12CC(C1)(C2)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)