CAS 24171-89-9 appears in our catalog under these names: Tris(2-thienyl)phosphine, 95%, Tri-2-thienylphosphine, 98%, Tris(2–thienyl)phosphine, Tris (2-thienyl)phosphine/ 98+%, Tri(2-thienyl)phosphine, >96.0%(GC). Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, TCI. Available pack sizes: 5g, 1g, 250mg, 25g, 10g, 100mg.
Trithiophen-2-ylphosphane (CAS 24171-89-9) is a chemical compound with the molecular formula C12H9PS3 and a molecular weight of 280.4 g/mol. IUPAC name: trithiophen-2-ylphosphane. InChIKey: KUCPTMZJPDVWJL-UHFFFAOYSA-N.
| Molecular formula | C12H9PS3 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | trithiophen-2-ylphosphane |
| InChIKey | KUCPTMZJPDVWJL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)P(C2=CC=CS2)C3=CC=CS3 |
Computed by PubChem (NCBI)