CAS 2417112-66-2 is the registry number for 5-Oxo-1,3a,4,5,6,6a-hexahydropentalen-2-yl trifluoromethanesulfonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl) trifluoromethanesulfonate (CAS 2417112-66-2) is a chemical compound with the molecular formula C9H9F3O4S and a molecular weight of 270.23 g/mol. IUPAC name: (5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl) trifluoromethanesulfonate. InChIKey: GCHBEHDQJNCDAS-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O4S |
|---|---|
| Molecular weight | 270.23 g/mol |
| IUPAC name | (5-oxo-3a,4,6,6a-tetrahydro-1H-pentalen-2-yl) trifluoromethanesulfonate |
| InChIKey | GCHBEHDQJNCDAS-UHFFFAOYSA-N |
| SMILES | C1C2CC(=CC2CC1=O)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)