Products 2417174-32-2
CAS 2417174-32-2 is the registry number for Succinic acid-Pomalidomide, 98.90%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 10 mg, 100 mg, 5 mg.
4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-4-oxobutanoic acid (CAS 2417174-32-2) is a chemical compound with the molecular formula C17H15N3O7 and a molecular weight of 373.3 g/mol. IUPAC name: 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-4-oxobutanoic acid. InChIKey: KAHBVOYMRWHLJX-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O7 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | 4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]-4-oxobutanoic acid |
| InChIKey | KAHBVOYMRWHLJX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)