CAS 24173-36-2 appears in our catalog under these names: 4-Azidobenzaldehyde, >95% (HPLC), 4–Azidobenzaldehyde, 4-Azidobenzaldehyde, 4-Azidobenzaldehyde, 90%, 90%. Offered by: TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 0,5g, 5g, 1g, 10g, 25g.
4-azidobenzaldehyde (CAS 24173-36-2) is a chemical compound with the molecular formula C7H5N3O and a molecular weight of 147.13 g/mol. IUPAC name: 4-azidobenzaldehyde. InChIKey: SDJOUGYEUFYPLL-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O |
|---|---|
| Molecular weight | 147.13 g/mol |
| IUPAC name | 4-azidobenzaldehyde |
| InChIKey | SDJOUGYEUFYPLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)N=[N+]=[N-] |
Computed by PubChem (NCBI)