CAS 2417419-28-2 appears in our catalog under these names: 3,6-Dibromo-1,4-dimethylquinolin-2(1H)-one, 95%, 3,6-Dibromo-1,4-dimethylquinolin-2(1H)-one, 95%, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
3,6-dibromo-1,4-dimethylquinolin-2-one (CAS 2417419-28-2) is a chemical compound with the molecular formula C11H9Br2NO and a molecular weight of 331.00 g/mol. IUPAC name: 3,6-dibromo-1,4-dimethylquinolin-2-one. InChIKey: SROMAQGZWDIBLQ-UHFFFAOYSA-N.
| Molecular formula | C11H9Br2NO |
|---|---|
| Molecular weight | 331.00 g/mol |
| IUPAC name | 3,6-dibromo-1,4-dimethylquinolin-2-one |
| InChIKey | SROMAQGZWDIBLQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C2=C1C=C(C=C2)Br)C)Br |
Computed by PubChem (NCBI)