Products 2417490-24-3
CAS 2417490-24-3 is the registry number for 5-Hydrazineyl-1-(4-methoxybenzyl)-1H-pyrazole dihydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
[2-[(4-methoxyphenyl)methyl]pyrazol-3-yl]hydrazine;dihydrochloride (CAS 2417490-24-3) is a chemical compound with the molecular formula C11H16Cl2N4O and a molecular weight of 291.17 g/mol. IUPAC name: [2-[(4-methoxyphenyl)methyl]pyrazol-3-yl]hydrazine;dihydrochloride. InChIKey: DJOWKVPZSBWULZ-UHFFFAOYSA-N.
| Molecular formula | C11H16Cl2N4O |
|---|---|
| Molecular weight | 291.17 g/mol |
| IUPAC name | [2-[(4-methoxyphenyl)methyl]pyrazol-3-yl]hydrazine;dihydrochloride |
| InChIKey | DJOWKVPZSBWULZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=CC=N2)NN.Cl.Cl |
Computed by PubChem (NCBI)