CAS 2417676-89-0 is the registry number for (Z)-1-Ethoxy-4,4,4-trifluoro-1-oxo-3-(pyridin-1-ium-1-yl)but-2-ene-2-thiolate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-1-ethoxy-4,4,4-trifluoro-1-oxo-3-pyridin-1-ium-1-ylbut-2-ene-2-thiolate (CAS 2417676-89-0) is a chemical compound with the molecular formula C11H10F3NO2S and a molecular weight of 277.26 g/mol. IUPAC name: (Z)-1-ethoxy-4,4,4-trifluoro-1-oxo-3-pyridin-1-ium-1-ylbut-2-ene-2-thiolate. InChIKey: SAADGXCZLWHGFX-HJWRWDBZSA-N.
| Molecular formula | C11H10F3NO2S |
|---|---|
| Molecular weight | 277.26 g/mol |
| IUPAC name | (Z)-1-ethoxy-4,4,4-trifluoro-1-oxo-3-pyridin-1-ium-1-ylbut-2-ene-2-thiolate |
| InChIKey | SAADGXCZLWHGFX-HJWRWDBZSA-N |
| SMILES | CCOC(=O)/C(=C(\C(F)(F)F)/[N+]1=CC=CC=C1)/[S-] |
Computed by PubChem (NCBI)