CAS 2417778-22-2 is the registry number for (3S,5R)-3-Amino-5-methylpyrrolidin-2-one hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,5R)-3-amino-5-methylpyrrolidin-2-one;hydrochloride (CAS 2417778-22-2) is a chemical compound with the molecular formula C5H11ClN2O and a molecular weight of 150.61 g/mol. IUPAC name: (3S,5R)-3-amino-5-methylpyrrolidin-2-one;hydrochloride. InChIKey: HWDJCLAPGZULCB-HJXLNUONSA-N.
| Molecular formula | C5H11ClN2O |
|---|---|
| Molecular weight | 150.61 g/mol |
| IUPAC name | (3S,5R)-3-amino-5-methylpyrrolidin-2-one;hydrochloride |
| InChIKey | HWDJCLAPGZULCB-HJXLNUONSA-N |
| SMILES | C[C@@H]1C[C@@H](C(=O)N1)N.Cl |
Computed by PubChem (NCBI)