CAS 2418-89-5 is the registry number for Dicyclohexylamine ((2-nitrophenyl)thio)-L-serinate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-cyclohexylcyclohexanamine;(2S)-3-hydroxy-2-[(2-nitrophenyl)sulfanylamino]propanoic acid (CAS 2418-89-5) is a chemical compound with the molecular formula C21H33N3O5S and a molecular weight of 439.6 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S)-3-hydroxy-2-[(2-nitrophenyl)sulfanylamino]propanoic acid. InChIKey: MFUIDDKVSATADN-ZCMDIHMWSA-N.
| Molecular formula | C21H33N3O5S |
|---|---|
| Molecular weight | 439.6 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S)-3-hydroxy-2-[(2-nitrophenyl)sulfanylamino]propanoic acid |
| InChIKey | MFUIDDKVSATADN-ZCMDIHMWSA-N |
| SMILES | C1CCC(CC1)NC2CCCCC2.C1=CC=C(C(=C1)[N+](=O)[O-])SN[C@@H](CO)C(=O)O |
Computed by PubChem (NCBI)