CAS 2418591-36-1 is the registry number for Dehydro Amlodipine N-Oxide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1-oxidopyridin-1-ium-3,5-dicarboxylate (CAS 2418591-36-1) is a chemical compound with the molecular formula C20H23ClN2O6 and a molecular weight of 422.9 g/mol. IUPAC name: 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1-oxidopyridin-1-ium-3,5-dicarboxylate. InChIKey: HMVRYAJKOKSVQM-UHFFFAOYSA-N.
| Molecular formula | C20H23ClN2O6 |
|---|---|
| Molecular weight | 422.9 g/mol |
| IUPAC name | 3-O-ethyl 5-O-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1-oxidopyridin-1-ium-3,5-dicarboxylate |
| InChIKey | HMVRYAJKOKSVQM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C([N+](=C1COCCN)[O-])C)C(=O)OC)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)