CAS 2418668-79-6 is the registry number for 3-Bromo-7-fluoro-1,5-naphthyridine 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-7-fluoro-1,5-naphthyridine (CAS 2418668-79-6) is a chemical compound with the molecular formula C8H4BrFN2 and a molecular weight of 227.03 g/mol. IUPAC name: 3-bromo-7-fluoro-1,5-naphthyridine. InChIKey: IBHREQRUTYAXMS-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFN2 |
|---|---|
| Molecular weight | 227.03 g/mol |
| IUPAC name | 3-bromo-7-fluoro-1,5-naphthyridine |
| InChIKey | IBHREQRUTYAXMS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1N=CC(=C2)Br)F |
Computed by PubChem (NCBI)