CAS 2418779-48-1 is the registry number for Antibacterial agent 254. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[2-[[(1R,2R)-2-hydroxycyclobutyl]amino]-2-oxoethyl]benzoic acid (CAS 2418779-48-1) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: 3-[2-[[(1R,2R)-2-hydroxycyclobutyl]amino]-2-oxoethyl]benzoic acid. InChIKey: XIKNZILHTTURQV-GHMZBOCLSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 3-[2-[[(1R,2R)-2-hydroxycyclobutyl]amino]-2-oxoethyl]benzoic acid |
| InChIKey | XIKNZILHTTURQV-GHMZBOCLSA-N |
| SMILES | C1C[C@H]([C@@H]1NC(=O)CC2=CC(=CC=C2)C(=O)O)O |
Computed by PubChem (NCBI)