CAS 24188-75-8 appears in our catalog under these names: 7-Chloro-3-methyl-1,2-dihydroisoquinolin-1-one, 95%, 7-Chloro-3-methyl-1,2-dihydroisoquinolin-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-chloro-3-methyl-2H-isoquinolin-1-one (CAS 24188-75-8) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: 7-chloro-3-methyl-2H-isoquinolin-1-one. InChIKey: CHXAYUSRURSBER-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 7-chloro-3-methyl-2H-isoquinolin-1-one |
| InChIKey | CHXAYUSRURSBER-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(C=C2)Cl)C(=O)N1 |
Computed by PubChem (NCBI)