CAS 2419129-87-4 is the registry number for (R)-8-Chloro-2-(2-(2,5-difluorophenyl)pyrrolidin-1-yl)-1,5-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-2-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1,5-naphthyridine (CAS 2419129-87-4) is a chemical compound with the molecular formula C18H14ClF2N3 and a molecular weight of 345.8 g/mol. IUPAC name: 8-chloro-2-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1,5-naphthyridine. InChIKey: WBBXIDXJTBEQBC-MRXNPFEDSA-N.
| Molecular formula | C18H14ClF2N3 |
|---|---|
| Molecular weight | 345.8 g/mol |
| IUPAC name | 8-chloro-2-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1,5-naphthyridine |
| InChIKey | WBBXIDXJTBEQBC-MRXNPFEDSA-N |
| SMILES | C1C[C@@H](N(C1)C2=NC3=C(C=CN=C3C=C2)Cl)C4=C(C=CC(=C4)F)F |
Computed by PubChem (NCBI)