Products 24194-09-0

CAS 24194-09-0 is the registry number for 2-[(4-Chlorophenyl)thio]ethanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg.

Structural formula: {0} (CAS {1})

2-(4-chlorophenyl)sulfanylethanamine;hydrochloride (CAS 24194-09-0) is a chemical compound with the molecular formula C8H11Cl2NS and a molecular weight of 224.15 g/mol. IUPAC name: 2-(4-chlorophenyl)sulfanylethanamine;hydrochloride. InChIKey: VHSTUSDEIPKDKG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11Cl2NS
Molecular weight224.15 g/mol
IUPAC name2-(4-chlorophenyl)sulfanylethanamine;hydrochloride
InChIKeyVHSTUSDEIPKDKG-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1SCCN)Cl.Cl

Computed by PubChem (NCBI)