Products 2420428-01-7
CAS 2420428-01-7 is the registry number for (S)-2-Bromo-6-(4-(sec-butyl)-4H-1,2,4-triazol-3-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-6-[4-[(2S)-butan-2-yl]-1,2,4-triazol-3-yl]pyridine (CAS 2420428-01-7) is a chemical compound with the molecular formula C11H13BrN4 and a molecular weight of 281.15 g/mol. IUPAC name: 2-bromo-6-[4-[(2S)-butan-2-yl]-1,2,4-triazol-3-yl]pyridine. InChIKey: JHVWXXKSYKJSJU-QMMMGPOBSA-N.
| Molecular formula | C11H13BrN4 |
|---|---|
| Molecular weight | 281.15 g/mol |
| IUPAC name | 2-bromo-6-[4-[(2S)-butan-2-yl]-1,2,4-triazol-3-yl]pyridine |
| InChIKey | JHVWXXKSYKJSJU-QMMMGPOBSA-N |
| SMILES | CC[C@H](C)N1C=NN=C1C2=NC(=CC=C2)Br |
Computed by PubChem (NCBI)