CAS 24209-43-6 is the registry number for Ceftezole Impurity 3. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(6R,7R)-7-amino-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 24209-43-6) is a chemical compound with the molecular formula C10H10N4O3S3 and a molecular weight of 330.4 g/mol. IUPAC name: (6R,7R)-7-amino-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: OBZPELDGSNYFTD-SVGQVSJJSA-N.
| Molecular formula | C10H10N4O3S3 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | (6R,7R)-7-amino-8-oxo-3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | OBZPELDGSNYFTD-SVGQVSJJSA-N |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)N)C(=O)O)CSC3=NN=CS3 |
Computed by PubChem (NCBI)