CAS 2421099-63-8 is the registry number for Copper(II) bis((trifluoromethyl)sulfonyl)amide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(bis(trifluoromethylsulfonyl)azanide) (CAS 2421099-63-8) is a chemical compound with the molecular formula C4CuF12N2O8S4 and a molecular weight of 623.8 g/mol. IUPAC name: copper bis(bis(trifluoromethylsulfonyl)azanide). InChIKey: UQENANCFJGYGSY-UHFFFAOYSA-N.
| Molecular formula | C4CuF12N2O8S4 |
|---|---|
| Molecular weight | 623.8 g/mol |
| IUPAC name | copper bis(bis(trifluoromethylsulfonyl)azanide) |
| InChIKey | UQENANCFJGYGSY-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.[Cu+2] |
Computed by PubChem (NCBI)