CAS 2421146-53-2 appears in our catalog under these names: Ametoctradin metabolite M650F06 hydrochloride, AMETOCTRADIN HYDROCHLORIDE METABOLITE M6, Ametoctradin Metabolite M650F06 hydrochloride, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards. Available pack sizes: 10mg, 1x10mg, 1x1ml.
6-(7-amino-5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)hexanoic acid;hydrochloride (CAS 2421146-53-2) is a chemical compound with the molecular formula C13H20ClN5O2 and a molecular weight of 313.78 g/mol. IUPAC name: 6-(7-amino-5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)hexanoic acid;hydrochloride. InChIKey: WIMSAVAWSKSJNK-UHFFFAOYSA-N.
| Molecular formula | C13H20ClN5O2 |
|---|---|
| Molecular weight | 313.78 g/mol |
| IUPAC name | 6-(7-amino-5-ethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)hexanoic acid;hydrochloride |
| InChIKey | WIMSAVAWSKSJNK-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=NC=NN2C(=C1CCCCCC(=O)O)N.Cl |
Computed by PubChem (NCBI)