CAS 24212-76-8 appears in our catalog under these names: 2,7-Dimethyl-9(10h)-acridinone, 95%, 2,7-DIMETHYL-9(10H)-ACRIDINONE. Offered by: Combi-blocks, Sigma-Aldrich. Available pack sizes: 1g.
2,7-dimethyl-10H-acridin-9-one (CAS 24212-76-8) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 2,7-dimethyl-10H-acridin-9-one. InChIKey: IBEGAUGEWHXHQH-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2,7-dimethyl-10H-acridin-9-one |
| InChIKey | IBEGAUGEWHXHQH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C(C2=O)C=C(C=C3)C |
Computed by PubChem (NCBI)