Products 2421217-23-2
CAS 2421217-23-2 appears in our catalog under these names: Uric acid–13C,15N3, Uric Acid-13C，15N3, 99%, 99%, Uric acid-13C,15N3, 99.20%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 1 mg.
7,9-dihydro-3H-purine-2,6,8-trione (CAS 2421217-23-2) is a chemical compound with the molecular formula C5H4N4O3 and a molecular weight of 172.08 g/mol. IUPAC name: 7,9-dihydro-3H-purine-2,6,8-trione. InChIKey: LEHOTFFKMJEONL-CIKYWDRWSA-N.
| Molecular formula | C5H4N4O3 |
|---|---|
| Molecular weight | 172.08 g/mol |
| IUPAC name | 7,9-dihydro-3H-purine-2,6,8-trione |
| InChIKey | LEHOTFFKMJEONL-CIKYWDRWSA-N |
| SMILES | C12=C(NC(=O)[15NH]1)[15NH][13C](=O)[15NH]C2=O |
Computed by PubChem (NCBI)