Products 2421262-07-7
CAS 2421262-07-7 is the registry number for ER ligand-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidine-4-carbaldehyde (CAS 2421262-07-7) is a chemical compound with the molecular formula C28H29NO2 and a molecular weight of 411.5 g/mol. IUPAC name: 1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidine-4-carbaldehyde. InChIKey: JMPCYLCGRVOFFU-BYYHNAKLSA-N.
| Molecular formula | C28H29NO2 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 1-[4-[(E)-1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenyl]piperidine-4-carbaldehyde |
| InChIKey | JMPCYLCGRVOFFU-BYYHNAKLSA-N |
| SMILES | CC/C(=C(/C1=CC=C(C=C1)N2CCC(CC2)C=O)\C3=CC=C(C=C3)O)/C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
ER ligand-5, orb2814458